Maximize
Maximize Maximize
  • 05-05-2016
  • Mathematics
contestada

Number 7 I don't really get it

Number 7 I dont really get it class=

Respuesta :

lime52
lime52 lime52
  • 05-05-2016
The triangle could be described as a right triangle or a scalene triangle. Since it has two perpendicular sides, or sides that intersect at a right angle, it has to be a right triangle. Because none of the sides are the same length, it has to be a scalene triangle, or a triangle in which no sides are equal.
Answer Link

Otras preguntas

two legs of a right triangle each measure 10 incles how long is the hypotenuse
PLEASE HELP QUICK FIRST GETS BRAINLYEST!!!!The diagram shows steps and structures involved in protein production. The arrow labeled X is pointing to
cosec(6b+pi/8)=sec(2b-pi/8)​
A line that includes the points (6,h) and (7,−10) has a slope of −7. ​ ​ What is the value of h ? ​
Solve this equation 4x-4=2x+8
the length of a rectangle is 3 yd longer than its width. if the perimeter of the rectangle is 34 yd, what is it's area.​
The points (6,y) and (7,9) fall on a line with a slope of 5 . ​ ​What is the value of y ? ​
4- -2 1/2 +5/3 answer please
What is the equation of the line that passes through the point (-2,5) and has a slope of -6?
How is the structure of Congress different under the articles of confederation and the constitution?