leah144
leah144 leah144
  • 01-01-2018
  • Advanced Placement (AP)
contestada

Which agent of erosion most likely formed the drumlins and finger lakes in New York State?

Respuesta :

angelaalien13
angelaalien13 angelaalien13
  • 01-01-2018
The Moving Ice :)
Happy New Year!!!! 
Answer Link

Otras preguntas

One significant way that blacks were able to enjoy economic independence was by settling in the West on federally provided public land. a. True b. False
How would I simplify 14.8+6.25+0.97
How is it possible for older adults to have satisfying sex lives?
Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl
Think about your favorite superhero. Write a four sentence paragraph about your favorite superhero. Why do you like this superhero? Why qualities do they posses
please help give bralienst not need explation
Let $n$ be a positive integer. (a) Prove that \[n^3 = n + 3n(n - 1) + 6 \binom{n}{3}\]by counting the number of ordered triples $(a,b,c)$ of positive integers,
Given below are two independent scenarios: a. Dream Co. has budgeted sales of $500,000, fixed costs are $240,000, and variable costs are $375,000. What is its c
Please help ASAP. The question is down below.
Fear of the ""mob"" or ""rabble"" during the post-revolution year caused authors of some state constitutions to